C13H24N2O3S — CID 134151934
(5S,6S,7S,7aR)-3-hexylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol (PubChem CID 134151934) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is (5S,6S,7S,7aR)-3-hexylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol.
| Compound Name | (5S,6S,7S,7aR)-3-hexylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 134151934 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (5S,6S,7S,7aR)-3-hexylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
| SMILES | CCCCCC/N=C1\SC[C@H]2[C@H](O)[C@@H](O)[C@H](CO)N12 |
| InChI | InChI=1S/C13H24N2O3S/c1-2-3-4-5-6-14-13-15-9(7-16)11(17)12(18)10(15)8-19-13/h9-12,16-18H,2-8H2,1H3/b14-13-/t9-,10-,11-,12-/m0/s1 |
| InChIKey | YGXIUMABRRLZFX-NKZQAIMISA-N |
| XLogP | 0.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|