C17H32N2O3S — CID 134133152
(5R,6R,7R,7aS)-3-decylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol (PubChem CID 134133152) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is (5R,6R,7R,7aS)-3-decylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol.
| Compound Name | (5R,6R,7R,7aS)-3-decylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 134133152 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (5R,6R,7R,7aS)-3-decylimino-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
| SMILES | CCCCCCCCCC/N=C1\SC[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)N12 |
| InChI | InChI=1S/C17H32N2O3S/c1-2-3-4-5-6-7-8-9-10-18-17-19-13(11-20)15(21)16(22)14(19)12-23-17/h13-16,20-22H,2-12H2,1H3/b18-17-/t13-,14-,15-,16-/m1/s1 |
| InChIKey | KZFUVJOWYFCJRT-WGKXRSGHSA-N |
| XLogP | 2.00 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|