C18H32N2O4S — CID 136721428
(3aR,5S,6S,6aR)-2,2-dimethyl-5-[(4R)-2-octylimino-1,3-thiazolidin-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 136721428) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is (3aR,5S,6S,6aR)-2,2-dimethyl-5-[(4R)-2-octylimino-1,3-thiazolidin-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6S,6aR)-2,2-dimethyl-5-[(4R)-2-octylimino-1,3-thiazolidin-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 136721428 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3aR,5S,6S,6aR)-2,2-dimethyl-5-[(4R)-2-octylimino-1,3-thiazolidin-4-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CCCCCCCC/N=C1/N[C@H]([C@@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O)CS1 |
| InChI | InChI=1S/C18H32N2O4S/c1-4-5-6-7-8-9-10-19-17-20-12(11-25-17)14-13(21)15-16(22-14)24-18(2,3)23-15/h12-16,21H,4-11H2,1-3H3,(H,19,20)/t12-,13-,14-,15+,16+/m0/s1 |
| InChIKey | BSCNHBVWFHNXLC-RFBLXINOSA-N |
| XLogP | 2.65 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|