C13H24S2 — CID 20549610
5,6-dibutyl-2-methyl-2,3-dihydro-1,4-dithiine (PubChem CID 20549610) has the molecular formula C13H24S2 and a molecular weight of 244.47 g/mol. Its IUPAC name is 5,6-dibutyl-2-methyl-2,3-dihydro-1,4-dithiine.
| Compound Name | 5,6-dibutyl-2-methyl-2,3-dihydro-1,4-dithiine |
|---|---|
| PubChem CID | 20549610 |
| Molecular Formula | C13H24S2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5,6-dibutyl-2-methyl-2,3-dihydro-1,4-dithiine |
| SMILES | CCCCC1=C(CCCC)SC(C)CS1 |
| InChI | InChI=1S/C13H24S2/c1-4-6-8-12-13(9-7-5-2)15-11(3)10-14-12/h11H,4-10H2,1-3H3 |
| InChIKey | LLWKMERHOXDRAP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |