C15H30INS — CID 70461135
3-decyl-2,4-dimethyl-4,5-dihydro-1,3-thiazol-3-ium iodide (PubChem CID 70461135) has the molecular formula C15H30INS and a molecular weight of 383.38 g/mol. Its IUPAC name is 3-decyl-2,4-dimethyl-4,5-dihydro-1,3-thiazol-3-ium iodide.
| Compound Name | 3-decyl-2,4-dimethyl-4,5-dihydro-1,3-thiazol-3-ium iodide |
|---|---|
| PubChem CID | 70461135 |
| Molecular Formula | C15H30INS |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-decyl-2,4-dimethyl-4,5-dihydro-1,3-thiazol-3-ium iodide |
| SMILES | CCCCCCCCCC[N+]1=C(C)SCC1C.[I-] |
| InChI | InChI=1S/C15H30NS.HI/c1-4-5-6-7-8-9-10-11-12-16-14(2)13-17-15(16)3;/h14H,4-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GLOLWEZHPMJXHW-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|