C21H33N2S+ — CID 69451250
4-[2-(3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 69451250) has the molecular formula C21H33N2S+ and a molecular weight of 345.58 g/mol. Its IUPAC name is 4-[2-(3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 69451250 |
| Molecular Formula | C21H33N2S+ |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 4-[2-(3-heptyl-4-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CCCCCCC[N+]1=C(C=Cc2ccc(N(C)C)cc2)SCC1C |
| InChI | InChI=1S/C21H33N2S/c1-5-6-7-8-9-16-23-18(2)17-24-21(23)15-12-19-10-13-20(14-11-19)22(3)4/h10-15,18H,5-9,16-17H2,1-4H3/q+1 |
| InChIKey | HILVZGLMVLCIRB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|