C12H18S3 — CID 145020682
3-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiine (PubChem CID 145020682) has the molecular formula C12H18S3 and a molecular weight of 258.48 g/mol. Its IUPAC name is 3-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiine.
| Compound Name | 3-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiine |
|---|---|
| PubChem CID | 145020682 |
| Molecular Formula | C12H18S3 |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-hexyl-2,3-dihydrothieno[3,4-b][1,4]dithiine |
| SMILES | CCCCCCC1CSc2cscc2S1 |
| InChI | InChI=1S/C12H18S3/c1-2-3-4-5-6-10-7-14-11-8-13-9-12(11)15-10/h8-10H,2-7H2,1H3 |
| InChIKey | GAEZBQBLYZZGSB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|