C10H17BrS — CID 123501371
5-bromo-3-hexyl-2,3-dihydrothiophene (PubChem CID 123501371) has the molecular formula C10H17BrS and a molecular weight of 249.22 g/mol. Its IUPAC name is 5-bromo-3-hexyl-2,3-dihydrothiophene.
| Compound Name | 5-bromo-3-hexyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 123501371 |
| Molecular Formula | C10H17BrS |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 5-bromo-3-hexyl-2,3-dihydrothiophene |
| SMILES | CCCCCCC1C=C(Br)SC1 |
| InChI | InChI=1S/C10H17BrS/c1-2-3-4-5-6-9-7-10(11)12-8-9/h7,9H,2-6,8H2,1H3 |
| InChIKey | FYWHPAZEXFFCBD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|