C11H20ClNS — CID 175989039
2-chloro-4-octyl-4,5-dihydro-1,3-thiazole (PubChem CID 175989039) has the molecular formula C11H20ClNS and a molecular weight of 233.81 g/mol. Its IUPAC name is 2-chloro-4-octyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-chloro-4-octyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 175989039 |
| Molecular Formula | C11H20ClNS |
| Molecular Weight | 233.81 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-chloro-4-octyl-4,5-dihydro-1,3-thiazole |
| SMILES | CCCCCCCCC1CSC(Cl)=N1 |
| InChI | InChI=1S/C11H20ClNS/c1-2-3-4-5-6-7-8-10-9-14-11(12)13-10/h10H,2-9H2,1H3 |
| InChIKey | KMSZIBQMUDZTNY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|