About 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone
1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone (PubChem CID 10662322) has the molecular formula C19H28OS
and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
| PubChem CID | 10662322 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
| SMILES | CCCCCCCCC1CCc2cc(C(C)=O)ccc2S1 |
| InChI | InChI=1S/C19H28OS/c1-3-4-5-6-7-8-9-18-12-10-17-14-16(15(2)20)11-13-19(17)21-18/h11,13-14,18H,3-10,12H2,1-2H3 |
| InChIKey | DNODNWJHBCQEOU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone?
The IUPAC name of 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone (CID 10662322) is 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone.
What is the SMILES notation for 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone?
The canonical SMILES for 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone is CCCCCCCCC1CCc2cc(C(C)=O)ccc2S1.
What is the InChIKey of 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone?
The InChIKey is DNODNWJHBCQEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28OS/c1-3-4-5-6-7-8-9-18-12-10-17-14-16(15(2)20)11-13-19(17)21-18/h11,13-14,18H,3-10,12H2,1-2H3.
What are the key properties of 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone?
1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone has a molecular weight of 304.50 g/mol, XLogP of 6.05, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone is sourced from PubChem (CID 10662322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).