C19H28OS — CID 10662322
1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone (PubChem CID 10662322) has the molecular formula C19H28OS and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone.
| Compound Name | 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
|---|---|
| PubChem CID | 10662322 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-(2-octyl-3,4-dihydro-2H-thiochromen-6-yl)ethanone |
| SMILES | CCCCCCCCC1CCc2cc(C(C)=O)ccc2S1 |
| InChI | InChI=1S/C19H28OS/c1-3-4-5-6-7-8-9-18-12-10-17-14-16(15(2)20)11-13-19(17)21-18/h11,13-14,18H,3-10,12H2,1-2H3 |
| InChIKey | DNODNWJHBCQEOU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|