C14H20OS — CID 139973351
2-butyl-7-methyl-3,4-dihydro-2H-thiochromen-6-ol (PubChem CID 139973351) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-butyl-7-methyl-3,4-dihydro-2H-thiochromen-6-ol.
| Compound Name | 2-butyl-7-methyl-3,4-dihydro-2H-thiochromen-6-ol |
|---|---|
| PubChem CID | 139973351 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-butyl-7-methyl-3,4-dihydro-2H-thiochromen-6-ol |
| SMILES | CCCCC1CCc2cc(O)c(C)cc2S1 |
| InChI | InChI=1S/C14H20OS/c1-3-4-5-12-7-6-11-9-13(15)10(2)8-14(11)16-12/h8-9,12,15H,3-7H2,1-2H3 |
| InChIKey | FWZRDUXAGLWUBN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |