C14H17NO2S — CID 11601366
6-acetyl-2-butyl-4H-1,4-benzothiazin-3-one (PubChem CID 11601366) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 6-acetyl-2-butyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-acetyl-2-butyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 11601366 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 6-acetyl-2-butyl-4H-1,4-benzothiazin-3-one |
| SMILES | CCCCC1Sc2ccc(C(C)=O)cc2NC1=O |
| InChI | InChI=1S/C14H17NO2S/c1-3-4-5-13-14(17)15-11-8-10(9(2)16)6-7-12(11)18-13/h6-8,13H,3-5H2,1-2H3,(H,15,17) |
| InChIKey | PUFJAQWNFJASSK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |