C11H10ClNO2S — CID 166899697
2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride (PubChem CID 166899697) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride.
| Compound Name | 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride |
|---|---|
| PubChem CID | 166899697 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride |
| SMILES | CCC1Sc2ccc(C(=O)Cl)cc2NC1=O |
| InChI | InChI=1S/C11H10ClNO2S/c1-2-8-11(15)13-7-5-6(10(12)14)3-4-9(7)16-8/h3-5,8H,2H2,1H3,(H,13,15) |
| InChIKey | JEGGTKMLVFWJAX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|