2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride

C11H10ClNO2S — CID 166899697

IUPAC2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride
SMILESCCC1Sc2ccc(C(=O)Cl)cc2NC1=O
InChIInChI=1S/C11H10ClNO2S/c1-2-8-11(15)13-7-5-6(10(12)14)3-4-9(7)16-8/h3-5,8H,2H2,1H3,(H,13,15)
InChIKeyJEGGTKMLVFWJAX-UHFFFAOYSA-N
MW255.73 g/mol
LogP2.89
Rot. Bonds2

About 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride

2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride (PubChem CID 166899697) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride.

Molecular Properties

Compound Name2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride
PubChem CID166899697
Molecular FormulaC11H10ClNO2S
Molecular Weight255.73 g/mol
Exact Mass255.01
IUPAC Name2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride
SMILESCCC1Sc2ccc(C(=O)Cl)cc2NC1=O
InChIInChI=1S/C11H10ClNO2S/c1-2-8-11(15)13-7-5-6(10(12)14)3-4-9(7)16-8/h3-5,8H,2H2,1H3,(H,13,15)
InChIKeyJEGGTKMLVFWJAX-UHFFFAOYSA-N
XLogP2.89
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.73
LogP ≤ 52.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride?
The IUPAC name of 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride (CID 166899697) is 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride.
What is the SMILES notation for 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride?
The canonical SMILES for 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride is CCC1Sc2ccc(C(=O)Cl)cc2NC1=O.
What is the InChIKey of 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride?
The InChIKey is JEGGTKMLVFWJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2S/c1-2-8-11(15)13-7-5-6(10(12)14)3-4-9(7)16-8/h3-5,8H,2H2,1H3,(H,13,15).
What are the key properties of 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride?
2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride has a molecular weight of 255.73 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-oxo-4H-1,4-benzothiazine-6-carbonyl chloride is sourced from PubChem (CID 166899697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).