C20H21NOS — CID 166446200
(2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-phenylethanone (PubChem CID 166446200) has the molecular formula C20H21NOS and a molecular weight of 323.46 g/mol. Its IUPAC name is (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-phenylethanone.
| Compound Name | (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 166446200 |
| Molecular Formula | C20H21NOS |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-phenylethanone |
| SMILES | CCCCC1Sc2ccccc2N/C1=C\C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21NOS/c1-2-3-12-20-17(14-18(22)15-9-5-4-6-10-15)21-16-11-7-8-13-19(16)23-20/h4-11,13-14,20-21H,2-3,12H2,1H3/b17-14- |
| InChIKey | AODQOPYLUADABQ-VKAVYKQESA-N |
| XLogP | 5.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|