C21H21NO3S — CID 166446198
methyl 3-[(3Z)-3-[2-(4-methylphenyl)-2-oxoethylidene]-4H-1,4-benzothiazin-2-yl]propanoate (PubChem CID 166446198) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is methyl 3-[(3Z)-3-[2-(4-methylphenyl)-2-oxoethylidene]-4H-1,4-benzothiazin-2-yl]propanoate.
| Compound Name | methyl 3-[(3Z)-3-[2-(4-methylphenyl)-2-oxoethylidene]-4H-1,4-benzothiazin-2-yl]propanoate |
|---|---|
| PubChem CID | 166446198 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 3-[(3Z)-3-[2-(4-methylphenyl)-2-oxoethylidene]-4H-1,4-benzothiazin-2-yl]propanoate |
| SMILES | COC(=O)CCC1Sc2ccccc2N/C1=C\C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-14-7-9-15(10-8-14)18(23)13-17-20(11-12-21(24)25-2)26-19-6-4-3-5-16(19)22-17/h3-10,13,20,22H,11-12H2,1-2H3/b17-13- |
| InChIKey | PIUYYHZOJTYBBC-LGMDPLHJSA-N |
| XLogP | 4.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|