C20H20FNOS — CID 166446202
(2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-(4-fluorophenyl)ethanone (PubChem CID 166446202) has the molecular formula C20H20FNOS and a molecular weight of 341.45 g/mol. Its IUPAC name is (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-(4-fluorophenyl)ethanone.
| Compound Name | (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 166446202 |
| Molecular Formula | C20H20FNOS |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2Z)-2-(2-butyl-4H-1,4-benzothiazin-3-ylidene)-1-(4-fluorophenyl)ethanone |
| SMILES | CCCCC1Sc2ccccc2N/C1=C\C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNOS/c1-2-3-7-20-17(22-16-6-4-5-8-19(16)24-20)13-18(23)14-9-11-15(21)12-10-14/h4-6,8-13,20,22H,2-3,7H2,1H3/b17-13- |
| InChIKey | HHROHSKQIGRBBZ-LGMDPLHJSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|