C16H19ClN2O4S — CID 120614277
(2S)-2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]hexanoic acid (PubChem CID 120614277) has the molecular formula C16H19ClN2O4S and a molecular weight of 370.86 g/mol. Its IUPAC name is (2S)-2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614277 |
| Molecular Formula | C16H19ClN2O4S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (2S)-2-[[2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CC1Sc2ccc(Cl)cc2NC1=O)C(=O)O |
| InChI | InChI=1S/C16H19ClN2O4S/c1-2-3-4-10(16(22)23)18-14(20)8-13-15(21)19-11-7-9(17)5-6-12(11)24-13/h5-7,10,13H,2-4,8H2,1H3,(H,18,20)(H,19,21)(H,22,23)/t10-,13?/m0/s1 |
| InChIKey | KGKCXEWGVIRYFE-NKUHCKNESA-N |
| XLogP | 2.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |