C19H19ClN2O3S — CID 51286535
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenoxypropyl)acetamide (PubChem CID 51286535) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenoxypropyl)acetamide.
| Compound Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenoxypropyl)acetamide |
|---|---|
| PubChem CID | 51286535 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenoxypropyl)acetamide |
| SMILES | O=C(CC1Sc2ccc(Cl)cc2NC1=O)NCCCOc1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O3S/c20-13-7-8-16-15(11-13)22-19(24)17(26-16)12-18(23)21-9-4-10-25-14-5-2-1-3-6-14/h1-3,5-8,11,17H,4,9-10,12H2,(H,21,23)(H,22,24) |
| InChIKey | ADVLKFDQUVHQFP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|