C19H17ClN4O2S2 — CID 55635903
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 55635903) has the molecular formula C19H17ClN4O2S2 and a molecular weight of 432.96 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55635903 |
| Molecular Formula | C19H17ClN4O2S2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | O=C(CC1Sc2ccc(Cl)cc2NC1=O)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H17ClN4O2S2/c20-11-5-6-15-13(9-11)23-18(26)16(27-15)10-17(25)21-7-8-22-19-24-12-3-1-2-4-14(12)28-19/h1-6,9,16H,7-8,10H2,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | LAYSXEICNRXOJP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|