C16H17ClN4O2S — CID 30944471
2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 30944471) has the molecular formula C16H17ClN4O2S and a molecular weight of 364.86 g/mol. Its IUPAC name is 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 30944471 |
| Molecular Formula | C16H17ClN4O2S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[(2R)-6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | O=C(C[C@H]1Sc2ccc(Cl)cc2NC1=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C16H17ClN4O2S/c17-11-2-3-13-12(8-11)20-16(23)14(24-13)9-15(22)19-4-1-6-21-7-5-18-10-21/h2-3,5,7-8,10,14H,1,4,6,9H2,(H,19,22)(H,20,23)/t14-/m1/s1 |
| InChIKey | QGMIXGFGZKBXDF-CQSZACIVSA-N |
| XLogP | 2.55 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|