C17H14ClN3O4S — CID 87019940
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-[(2-nitrophenyl)methyl]acetamide (PubChem CID 87019940) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-[(2-nitrophenyl)methyl]acetamide.
| Compound Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-[(2-nitrophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 87019940 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-[(2-nitrophenyl)methyl]acetamide |
| SMILES | O=C(CC1Sc2ccc(Cl)cc2NC1=O)NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O4S/c18-11-5-6-14-12(7-11)20-17(23)15(26-14)8-16(22)19-9-10-3-1-2-4-13(10)21(24)25/h1-7,15H,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | XEWULSALQWFDEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|