C19H15ClN2O2S — CID 51332737
2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylprop-2-ynyl)acetamide (PubChem CID 51332737) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylprop-2-ynyl)acetamide.
| Compound Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylprop-2-ynyl)acetamide |
|---|---|
| PubChem CID | 51332737 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-(6-chloro-3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylprop-2-ynyl)acetamide |
| SMILES | O=C(CC1Sc2ccc(Cl)cc2NC1=O)NCC#Cc1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c20-14-8-9-16-15(11-14)22-19(24)17(25-16)12-18(23)21-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,17H,10,12H2,(H,21,23)(H,22,24) |
| InChIKey | UDBPQXJJVOTQAJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|