C22H21F2NO4 — CID 102481486
ethyl 1-acetyl-2,6-bis(4-fluorophenyl)-4-oxopiperidine-3-carboxylate (PubChem CID 102481486) has the molecular formula C22H21F2NO4 and a molecular weight of 401.41 g/mol. Its IUPAC name is ethyl 1-acetyl-2,6-bis(4-fluorophenyl)-4-oxopiperidine-3-carboxylate.
| Compound Name | ethyl 1-acetyl-2,6-bis(4-fluorophenyl)-4-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 102481486 |
| Molecular Formula | C22H21F2NO4 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | ethyl 1-acetyl-2,6-bis(4-fluorophenyl)-4-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(c2ccc(F)cc2)N(C(C)=O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21F2NO4/c1-3-29-22(28)20-19(27)12-18(14-4-8-16(23)9-5-14)25(13(2)26)21(20)15-6-10-17(24)11-7-15/h4-11,18,20-21H,3,12H2,1-2H3 |
| InChIKey | CTFYWZXIQVYYTO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|