C21H22FNO4 — CID 127052316
ethyl (3S,4R,5S)-1-benzyl-4-(4-fluorophenyl)-5-hydroxy-2-oxopiperidine-3-carboxylate (PubChem CID 127052316) has the molecular formula C21H22FNO4 and a molecular weight of 371.40 g/mol. Its IUPAC name is ethyl (3S,4R,5S)-1-benzyl-4-(4-fluorophenyl)-5-hydroxy-2-oxopiperidine-3-carboxylate.
| Compound Name | ethyl (3S,4R,5S)-1-benzyl-4-(4-fluorophenyl)-5-hydroxy-2-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 127052316 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl (3S,4R,5S)-1-benzyl-4-(4-fluorophenyl)-5-hydroxy-2-oxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]([C@@H](CN(C1=O)CC2=CC=CC=C2)O)C3=CC=C(C=C3)F |
| InChI | InChI=1S/C21H22FNO4/c1-2-27-21(26)19-18(15-8-10-16(22)11-9-15)17(24)13-23(20(19)25)12-14-6-4-3-5-7-14/h3-11,17-19,24H,2,12-13H2,1H3/t17-,18-,19+/m1/s1 |
| InChIKey | SPIQTWYJGYNQCU-QRVBRYPASA-N |
| XLogP | 2.60 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 514 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|