C91H62N4 — CID 102481735
5,10,15-tris(2,4,6-triphenylphenyl)-22,24-dihydro-21H-corrin (PubChem CID 102481735) has the molecular formula C91H62N4 and a molecular weight of 1211.53 g/mol. Its IUPAC name is 5,10,15-tris(2,4,6-triphenylphenyl)-22,24-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2,4,6-triphenylphenyl)-22,24-dihydro-21H-corrin |
|---|---|
| PubChem CID | 102481735 |
| Molecular Formula | C91H62N4 |
| Molecular Weight | 1211.53 g/mol |
| Exact Mass | 1210.50 |
| IUPAC Name | 5,10,15-tris(2,4,6-triphenylphenyl)-22,24-dihydro-21H-corrin |
| SMILES | C1=Cc2nc1c(-c1c(-c3ccccc3)cc(-c3ccccc3)cc1-c1ccccc1)c1ccc([nH]1)c(-c1c(-c3ccccc3)cc(-c3ccccc3)cc1-c1ccccc1)c1ccc([nH]1)c1ccc([nH]1)c2-c1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C91H62N4/c1-10-28-60(29-11-1)69-54-72(63-34-16-4-17-35-63)86(73(55-69)64-36-18-5-19-37-64)89-80-48-46-78(92-80)79-47-49-81(93-79)90(87-74(65-38-20-6-21-39-65)56-70(61-30-12-2-13-31-61)57-75(87)66-40-22-7-23-41-66)83-51-53-85(95-83)91(84-52-50-82(89)94-84)88-76(67-42-24-8-25-43-67)58-71(62-32-14-3-15-33-62)59-77(88)68-44-26-9-27-45-68/h1-59,92-94H/b79-78-,89-80+,89-82+,90-81+,90-83+,91-84+,91-85+ |
| InChIKey | MVUILUVQCWKAHG-MZEGPSSHSA-N |
| XLogP | 24.70 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1211.53 |
| LogP ≤ 5 | 24.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |