C14H16O4 — CID 102482576
(5R,9S)-9-(3-methoxyphenyl)-1,7-dioxaspiro[4.4]nonan-8-one (PubChem CID 102482576) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (5R,9S)-9-(3-methoxyphenyl)-1,7-dioxaspiro[4.4]nonan-8-one.
| Compound Name | (5R,9S)-9-(3-methoxyphenyl)-1,7-dioxaspiro[4.4]nonan-8-one |
|---|---|
| PubChem CID | 102482576 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (5R,9S)-9-(3-methoxyphenyl)-1,7-dioxaspiro[4.4]nonan-8-one |
| SMILES | COc1cccc([C@@H]2C(=O)OC[C@@]23CCCO3)c1 |
| InChI | InChI=1S/C14H16O4/c1-16-11-5-2-4-10(8-11)12-13(15)17-9-14(12)6-3-7-18-14/h2,4-5,8,12H,3,6-7,9H2,1H3/t12-,14+/m1/s1 |
| InChIKey | QVEXEULSPOKVAD-OCCSQVGLSA-N |
| XLogP | 1.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |