C18H30N4O9 — CID 102482945
methyl 3-[4,6,10-trihydroxy-5,7-bis(3-methoxy-3-oxopropyl)-1,4,6,10-tetrazatricyclo[3.3.1.13,7]decan-3-yl]propanoate (PubChem CID 102482945) has the molecular formula C18H30N4O9 and a molecular weight of 446.46 g/mol. Its IUPAC name is methyl 3-[4,6,10-trihydroxy-5,7-bis(3-methoxy-3-oxopropyl)-1,4,6,10-tetrazatricyclo[3.3.1.13,7]decan-3-yl]propanoate.
| Compound Name | methyl 3-[4,6,10-trihydroxy-5,7-bis(3-methoxy-3-oxopropyl)-1,4,6,10-tetrazatricyclo[3.3.1.13,7]decan-3-yl]propanoate |
|---|---|
| PubChem CID | 102482945 |
| Molecular Formula | C18H30N4O9 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl 3-[4,6,10-trihydroxy-5,7-bis(3-methoxy-3-oxopropyl)-1,4,6,10-tetrazatricyclo[3.3.1.13,7]decan-3-yl]propanoate |
| SMILES | COC(=O)CCC12CN3CC(CCC(=O)OC)(N1O)N(O)C(CCC(=O)OC)(C3)N2O |
| InChI | InChI=1S/C18H30N4O9/c1-29-13(23)4-7-16-10-19-11-17(20(16)26,8-5-14(24)30-2)22(28)18(12-19,21(16)27)9-6-15(25)31-3/h26-28H,4-12H2,1-3H3 |
| InChIKey | HLQCVKAPTVVHCM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|