C24H32BN4O9- — CID 122375592
methyl 3-[6,12-bis(3-methoxy-3-oxopropyl)-9-phenyl-8,10,13-trioxa-1,4,7,11-tetraza-9-boranuidapentacyclo[7.3.1.14,12.02,7.06,11]tetradecan-2-yl]propanoate (PubChem CID 122375592) has the molecular formula C24H32BN4O9- and a molecular weight of 531.35 g/mol. Its IUPAC name is methyl 3-[6,12-bis(3-methoxy-3-oxopropyl)-9-phenyl-8,10,13-trioxa-1,4,7,11-tetraza-9-boranuidapentacyclo[7.3.1.14,12.02,7.06,11]tetradecan-2-yl]propanoate.
| Compound Name | methyl 3-[6,12-bis(3-methoxy-3-oxopropyl)-9-phenyl-8,10,13-trioxa-1,4,7,11-tetraza-9-boranuidapentacyclo[7.3.1.14,12.02,7.06,11]tetradecan-2-yl]propanoate |
|---|---|
| PubChem CID | 122375592 |
| Molecular Formula | C24H32BN4O9- |
| Molecular Weight | 531.35 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | methyl 3-[6,12-bis(3-methoxy-3-oxopropyl)-9-phenyl-8,10,13-trioxa-1,4,7,11-tetraza-9-boranuidapentacyclo[7.3.1.14,12.02,7.06,11]tetradecan-2-yl]propanoate |
| SMILES | COC(=O)CCC12CN3CC4(CCC(=O)OC)N1O[B-]1(c5ccccc5)ON2C(CCC(=O)OC)(C3)N4O1 |
| InChI | InChI=1S/C24H32BN4O9/c1-33-19(30)9-12-22-15-26-16-23(13-10-20(31)34-2)27(22)36-25(18-7-5-4-6-8-18)37-28(22)24(17-26,29(23)38-25)14-11-21(32)35-3/h4-8H,9-17H2,1-3H3/q-1 |
| InChIKey | RCABUAIXURTIQN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 119.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|