C27H17N3 — CID 102483282
2-(1H-indol-3-yl)-4-phenyl-9H-indeno[2,1-b]pyridine-3-carbonitrile (PubChem CID 102483282) has the molecular formula C27H17N3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-4-phenyl-9H-indeno[2,1-b]pyridine-3-carbonitrile.
| Compound Name | 2-(1H-indol-3-yl)-4-phenyl-9H-indeno[2,1-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102483282 |
| Molecular Formula | C27H17N3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-4-phenyl-9H-indeno[2,1-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2c[nH]c3ccccc23)nc2c(c1-c1ccccc1)-c1ccccc1C2 |
| InChI | InChI=1S/C27H17N3/c28-15-21-25(17-8-2-1-3-9-17)26-19-11-5-4-10-18(19)14-24(26)30-27(21)22-16-29-23-13-7-6-12-20(22)23/h1-13,16,29H,14H2 |
| InChIKey | ZWGMASODSPGTNB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |