C17H11ClN2 — CID 139310265
2-chloro-4-phenyl-9H-indeno[2,1-d]pyrimidine (PubChem CID 139310265) has the molecular formula C17H11ClN2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-chloro-4-phenyl-9H-indeno[2,1-d]pyrimidine.
| Compound Name | 2-chloro-4-phenyl-9H-indeno[2,1-d]pyrimidine |
|---|---|
| PubChem CID | 139310265 |
| Molecular Formula | C17H11ClN2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-4-phenyl-9H-indeno[2,1-d]pyrimidine |
| SMILES | Clc1nc2c(c(-c3ccccc3)n1)-c1ccccc1C2 |
| InChI | InChI=1S/C17H11ClN2/c18-17-19-14-10-12-8-4-5-9-13(12)15(14)16(20-17)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | UCZJRIVSOAOORD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |