C14H11ClN2 — CID 142568227
2-chloro-4-phenyl-7,8-dihydroquinazoline (PubChem CID 142568227) has the molecular formula C14H11ClN2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-chloro-4-phenyl-7,8-dihydroquinazoline.
| Compound Name | 2-chloro-4-phenyl-7,8-dihydroquinazoline |
|---|---|
| PubChem CID | 142568227 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-chloro-4-phenyl-7,8-dihydroquinazoline |
| SMILES | Clc1nc2c(c(-c3ccccc3)n1)C=CCC2 |
| InChI | InChI=1S/C14H11ClN2/c15-14-16-12-9-5-4-8-11(12)13(17-14)10-6-2-1-3-7-10/h1-4,6-8H,5,9H2 |
| InChIKey | ZFBZUUMWXGCFIH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |