C24H17BrN2 — CID 134285471
2-(4-bromophenyl)-4-naphthalen-2-yl-7,8-dihydroquinazoline (PubChem CID 134285471) has the molecular formula C24H17BrN2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-naphthalen-2-yl-7,8-dihydroquinazoline.
| Compound Name | 2-(4-bromophenyl)-4-naphthalen-2-yl-7,8-dihydroquinazoline |
|---|---|
| PubChem CID | 134285471 |
| Molecular Formula | C24H17BrN2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-(4-bromophenyl)-4-naphthalen-2-yl-7,8-dihydroquinazoline |
| SMILES | Brc1ccc(-c2nc3c(c(-c4ccc5ccccc5c4)n2)C=CCC3)cc1 |
| InChI | InChI=1S/C24H17BrN2/c25-20-13-11-17(12-14-20)24-26-22-8-4-3-7-21(22)23(27-24)19-10-9-16-5-1-2-6-18(16)15-19/h1-3,5-7,9-15H,4,8H2 |
| InChIKey | LKQRZUAFHXUFSX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |