C20H22N2O4 — CID 102483997
(E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 102483997) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102483997 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-1-(2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane]-3-yl)-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | CC1(C)C2CCC(C2)C12CC(C(=O)/C=C/c1cccc([N+](=O)[O-])c1)=NO2 |
| InChI | InChI=1S/C20H22N2O4/c1-19(2)14-7-8-15(11-14)20(19)12-17(21-26-20)18(23)9-6-13-4-3-5-16(10-13)22(24)25/h3-6,9-10,14-15H,7-8,11-12H2,1-2H3/b9-6+ |
| InChIKey | HKFXZARLZSMHOD-RMKNXTFCSA-N |
| XLogP | 4.15 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|