C21H20O4 — CID 102487170
ethyl (1R,5S)-3-hydroxy-4-methyl-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate (PubChem CID 102487170) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl (1R,5S)-3-hydroxy-4-methyl-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5S)-3-hydroxy-4-methyl-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102487170 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl (1R,5S)-3-hydroxy-4-methyl-2-oxo-1,5-diphenylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)C(=O)C(O)=C(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H20O4/c1-3-25-20(24)21(16-12-8-5-9-13-16)17(14(2)18(22)19(21)23)15-10-6-4-7-11-15/h4-13,17,22H,3H2,1-2H3/t17-,21+/m1/s1 |
| InChIKey | VMBIAOCTRQHFPF-UTKZUKDTSA-N |
| XLogP | 3.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|