C17H21F3N2O4 — CID 10248814
2,2,2-trifluoro-N-[[(2S,5Z,6R)-5-hydroxyimino-6-methoxyoxan-2-yl]methyl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 10248814) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(2S,5Z,6R)-5-hydroxyimino-6-methoxyoxan-2-yl]methyl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(2S,5Z,6R)-5-hydroxyimino-6-methoxyoxan-2-yl]methyl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 10248814 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(2S,5Z,6R)-5-hydroxyimino-6-methoxyoxan-2-yl]methyl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | CO[C@@H]1O[C@H](CN(C(=O)C(F)(F)F)[C@@H](C)c2ccccc2)CC/C1=N/O |
| InChI | InChI=1S/C17H21F3N2O4/c1-11(12-6-4-3-5-7-12)22(16(23)17(18,19)20)10-13-8-9-14(21-24)15(25-2)26-13/h3-7,11,13,15,24H,8-10H2,1-2H3/b21-14-/t11-,13-,15+/m0/s1 |
| InChIKey | SGIDKVCEAQHVMO-JIRXTNAQSA-N |
| XLogP | 3.12 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|