C16H18F3N5O5 — CID 10341891
[(3S,6S)-3-azido-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]oxan-2-yl] nitrate (PubChem CID 10341891) has the molecular formula C16H18F3N5O5 and a molecular weight of 417.34 g/mol. Its IUPAC name is [(3S,6S)-3-azido-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]oxan-2-yl] nitrate.
| Compound Name | [(3S,6S)-3-azido-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]oxan-2-yl] nitrate |
|---|---|
| PubChem CID | 10341891 |
| Molecular Formula | C16H18F3N5O5 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(3S,6S)-3-azido-6-[[[(1R)-1-phenylethyl]-(2,2,2-trifluoroacetyl)amino]methyl]oxan-2-yl] nitrate |
| SMILES | C[C@H](c1ccccc1)N(C[C@@H]1CC[C@H](N=[N+]=[N-])C(O[N+](=O)[O-])O1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H18F3N5O5/c1-10(11-5-3-2-4-6-11)23(15(25)16(17,18)19)9-12-7-8-13(21-22-20)14(28-12)29-24(26)27/h2-6,10,12-14H,7-9H2,1H3/t10-,12+,13+,14?/m1/s1 |
| InChIKey | DVPBGVNYYJGQLD-QNDAJOIBSA-N |
| XLogP | 3.53 |
| TPSA | 130.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|