C17H21F3N4O3 — CID 10475223
N-[[(2S,5S)-5-azido-6-methoxyoxan-2-yl]methyl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 10475223) has the molecular formula C17H21F3N4O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is N-[[(2S,5S)-5-azido-6-methoxyoxan-2-yl]methyl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | N-[[(2S,5S)-5-azido-6-methoxyoxan-2-yl]methyl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 10475223 |
| Molecular Formula | C17H21F3N4O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[[(2S,5S)-5-azido-6-methoxyoxan-2-yl]methyl]-2,2,2-trifluoro-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | COC1O[C@H](CN(C(=O)C(F)(F)F)[C@H](C)c2ccccc2)CC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H21F3N4O3/c1-11(12-6-4-3-5-7-12)24(16(25)17(18,19)20)10-13-8-9-14(22-23-21)15(26-2)27-13/h3-7,11,13-15H,8-10H2,1-2H3/t11-,13+,14+,15?/m1/s1 |
| InChIKey | YUVHTFZNHKRJMY-LKWLHFCZSA-N |
| XLogP | 3.97 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|