C23H34OSi2 — CID 102488869
trimethyl-[2-phenyl-1-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)propan-2-yl]oxysilane (PubChem CID 102488869) has the molecular formula C23H34OSi2 and a molecular weight of 382.70 g/mol. Its IUPAC name is trimethyl-[2-phenyl-1-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)propan-2-yl]oxysilane.
| Compound Name | trimethyl-[2-phenyl-1-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 102488869 |
| Molecular Formula | C23H34OSi2 |
| Molecular Weight | 382.70 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | trimethyl-[2-phenyl-1-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)propan-2-yl]oxysilane |
| SMILES | CC1(CC(C)(O[Si](C)(C)C)c2ccccc2)C[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H34OSi2/c1-22(18-26(6,7)21-16-12-11-15-20(21)22)17-23(2,24-25(3,4)5)19-13-9-8-10-14-19/h8-16H,17-18H2,1-7H3 |
| InChIKey | SNKLUDMJPNESFT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|