C13H17NSi — CID 102478898
2-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)acetonitrile (PubChem CID 102478898) has the molecular formula C13H17NSi and a molecular weight of 215.37 g/mol. Its IUPAC name is 2-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)acetonitrile.
| Compound Name | 2-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 102478898 |
| Molecular Formula | C13H17NSi |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(1,1,3-trimethyl-2H-1-benzosilol-3-yl)acetonitrile |
| SMILES | CC1(CC#N)C[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H17NSi/c1-13(8-9-14)10-15(2,3)12-7-5-4-6-11(12)13/h4-7H,8,10H2,1-3H3 |
| InChIKey | OJVDOUWNTKTHGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|