C45H34N4O4 — CID 102490181
methyl 4-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-N-(4-methoxycarbonylphenyl)anilino]benzoate (PubChem CID 102490181) has the molecular formula C45H34N4O4 and a molecular weight of 694.79 g/mol. Its IUPAC name is methyl 4-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-N-(4-methoxycarbonylphenyl)anilino]benzoate.
| Compound Name | methyl 4-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-N-(4-methoxycarbonylphenyl)anilino]benzoate |
|---|---|
| PubChem CID | 102490181 |
| Molecular Formula | C45H34N4O4 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | methyl 4-[4-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-N-(4-methoxycarbonylphenyl)anilino]benzoate |
| SMILES | COC(=O)c1ccc(N(c2ccc(/C=C/c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)cc2)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C45H34N4O4/c1-52-44(50)34-17-23-38(24-18-34)49(39-25-19-35(20-26-39)45(51)53-2)37-21-13-32(14-22-37)10-9-31-11-15-33(16-12-31)36-29-42(40-7-3-5-27-46-40)48-43(30-36)41-8-4-6-28-47-41/h3-30H,1-2H3/b10-9+ |
| InChIKey | OVKMSVNABMSCBL-MDZDMXLPSA-N |
| XLogP | 10.09 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|