C32H16N4 — CID 102492464
2-[10-(dicyanomethylidene)-2,6-diphenylanthracen-9-ylidene]propanedinitrile (PubChem CID 102492464) has the molecular formula C32H16N4 and a molecular weight of 456.51 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2,6-diphenylanthracen-9-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2,6-diphenylanthracen-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102492464 |
| Molecular Formula | C32H16N4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2,6-diphenylanthracen-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=c1c2ccc(-c3ccccc3)cc2c(=C(C#N)C#N)c2ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C32H16N4/c33-17-25(18-34)31-28-14-12-24(22-9-5-2-6-10-22)16-30(28)32(26(19-35)20-36)27-13-11-23(15-29(27)31)21-7-3-1-4-8-21/h1-16H |
| InChIKey | KCTAKKAIIIZEFL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|