C20H19N3O3 — CID 102492762
3-[[bis(pyridin-2-ylmethyl)amino]methyl]-2,4-dihydroxybenzaldehyde (PubChem CID 102492762) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-[[bis(pyridin-2-ylmethyl)amino]methyl]-2,4-dihydroxybenzaldehyde.
| Compound Name | 3-[[bis(pyridin-2-ylmethyl)amino]methyl]-2,4-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 102492762 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-[[bis(pyridin-2-ylmethyl)amino]methyl]-2,4-dihydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1O |
| InChI | InChI=1S/C20H19N3O3/c24-14-15-7-8-19(25)18(20(15)26)13-23(11-16-5-1-3-9-21-16)12-17-6-2-4-10-22-17/h1-10,14,25-26H,11-13H2 |
| InChIKey | VCGJYYIZYLMKJN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|