C26H23N5O3 — CID 136672894
4-[[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]diazenyl]benzoic acid (PubChem CID 136672894) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]diazenyl]benzoic acid.
| Compound Name | 4-[[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136672894 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-[[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2ccc(O)c(CN(Cc3ccccn3)Cc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C26H23N5O3/c32-25-12-11-22(30-29-21-9-7-19(8-10-21)26(33)34)15-20(25)16-31(17-23-5-1-3-13-27-23)18-24-6-2-4-14-28-24/h1-15,32H,16-18H2,(H,33,34)/b30-29+ |
| InChIKey | LMMKEDBKWKLYFD-QVIHXGFCSA-N |
| XLogP | 5.50 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|