C38H35N9O3 — CID 135458070
2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-[(4-nitrophenyl)diazenyl]phenol (PubChem CID 135458070) has the molecular formula C38H35N9O3 and a molecular weight of 665.76 g/mol. Its IUPAC name is 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-[(4-nitrophenyl)diazenyl]phenol.
| Compound Name | 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-[(4-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 135458070 |
| Molecular Formula | C38H35N9O3 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-[(4-nitrophenyl)diazenyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc(CN(Cc3ccccn3)Cc3ccccn3)c(O)c(CN(Cc3ccccn3)Cc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C38H35N9O3/c48-38-29(23-45(25-32-9-1-5-17-39-32)26-33-10-2-6-18-40-33)21-36(44-43-31-13-15-37(16-14-31)47(49)50)22-30(38)24-46(27-34-11-3-7-19-41-34)28-35-12-4-8-20-42-35/h1-22,48H,23-28H2/b44-43+ |
| InChIKey | NTTPLQGQKIYHIN-VGFSZAGXSA-N |
| XLogP | 7.70 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|