C27H31NO3 — CID 102494111
N-[2-[2-[hydroxy(diphenyl)methyl]-4-methoxyphenyl]ethyl]-2,2-dimethylpropanamide (PubChem CID 102494111) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[2-[2-[hydroxy(diphenyl)methyl]-4-methoxyphenyl]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[2-[hydroxy(diphenyl)methyl]-4-methoxyphenyl]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 102494111 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[2-[2-[hydroxy(diphenyl)methyl]-4-methoxyphenyl]ethyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(CCNC(=O)C(C)(C)C)c(C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H31NO3/c1-26(2,3)25(29)28-18-17-20-15-16-23(31-4)19-24(20)27(30,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-16,19,30H,17-18H2,1-4H3,(H,28,29) |
| InChIKey | CLQBGJZJKRBCSA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|