C22H21NO5S — CID 102495304
ethyl 2-[(2Z,5S)-3-benzyl-1,4-dioxo-2-phenacylidene-1,3-thiazolidin-5-yl]acetate (PubChem CID 102495304) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is ethyl 2-[(2Z,5S)-3-benzyl-1,4-dioxo-2-phenacylidene-1,3-thiazolidin-5-yl]acetate.
| Compound Name | ethyl 2-[(2Z,5S)-3-benzyl-1,4-dioxo-2-phenacylidene-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 102495304 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | ethyl 2-[(2Z,5S)-3-benzyl-1,4-dioxo-2-phenacylidene-1,3-thiazolidin-5-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)N(Cc2ccccc2)/C(=C/C(=O)c2ccccc2)S1=O |
| InChI | InChI=1S/C22H21NO5S/c1-2-28-21(25)14-19-22(26)23(15-16-9-5-3-6-10-16)20(29(19)27)13-18(24)17-11-7-4-8-12-17/h3-13,19H,2,14-15H2,1H3/b20-13-/t19-,29?/m0/s1 |
| InChIKey | CTZCFTORTVHVHY-PIBTUPIBSA-N |
| XLogP | 2.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|