C26H26BNO2 — CID 102495452
1-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]isoquinoline (PubChem CID 102495452) has the molecular formula C26H26BNO2 and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]isoquinoline.
| Compound Name | 1-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]isoquinoline |
|---|---|
| PubChem CID | 102495452 |
| Molecular Formula | C26H26BNO2 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]isoquinoline |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)c(-c2nccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C26H26BNO2/c1-17-16-22(27-29-25(2,3)26(4,5)30-27)23(21-13-9-8-11-19(17)21)24-20-12-7-6-10-18(20)14-15-28-24/h6-16H,1-5H3 |
| InChIKey | LMBLIYXJLAYMED-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|