About methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate
methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate (PubChem CID 102497002) has the molecular formula C16H23NO5
and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate |
| PubChem CID | 102497002 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate |
| SMILES | COC(=O)[C@@](C)(OC(=O)Nc1ccccc1OC)C(C)(C)C |
| InChI | InChI=1S/C16H23NO5/c1-15(2,3)16(4,13(18)21-6)22-14(19)17-11-9-7-8-10-12(11)20-5/h7-10H,1-6H3,(H,17,19)/t16-/m1/s1 |
| InChIKey | DDWUTXDEGDGZQI-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate?
The IUPAC name of methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate (CID 102497002) is methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate.
What is the SMILES notation for methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate?
The canonical SMILES for methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate is COC(=O)[C@@](C)(OC(=O)Nc1ccccc1OC)C(C)(C)C.
What is the InChIKey of methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate?
The InChIKey is DDWUTXDEGDGZQI-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H23NO5/c1-15(2,3)16(4,13(18)21-6)22-14(19)17-11-9-7-8-10-12(11)20-5/h7-10H,1-6H3,(H,17,19)/t16-/m1/s1.
What are the key properties of methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate?
methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate has a molecular weight of 309.36 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2-methoxyphenyl)carbamoyloxy]-2,3,3-trimethylbutanoate is sourced from PubChem (CID 102497002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).