C23H18F6N2S — CID 102497020
2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-pyridin-2-ylpyridine (PubChem CID 102497020) has the molecular formula C23H18F6N2S and a molecular weight of 468.47 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-pyridin-2-ylpyridine.
| Compound Name | 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 102497020 |
| Molecular Formula | C23H18F6N2S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethyl-6-pyridin-2-ylpyridine |
| SMILES | Cc1cc(C2=C(c3nc(-c4ccccn4)c(C)cc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C23H18F6N2S/c1-11-9-12(2)20(31-19(11)16-7-5-6-8-30-16)18-17(15-10-13(3)32-14(15)4)21(24,25)23(28,29)22(18,26)27/h5-10H,1-4H3 |
| InChIKey | GYBBQZFEXSACDI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|