C19H13N3O — CID 102500858
N-[4-(1,3-benzoxazol-2-yl)phenyl]-1-pyridin-2-ylmethanimine (PubChem CID 102500858) has the molecular formula C19H13N3O and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-1-pyridin-2-ylmethanimine.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 102500858 |
| Molecular Formula | C19H13N3O |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-1-pyridin-2-ylmethanimine |
| SMILES | C(=N/c1ccc(-c2nc3ccccc3o2)cc1)\c1ccccn1 |
| InChI | InChI=1S/C19H13N3O/c1-2-7-18-17(6-1)22-19(23-18)14-8-10-15(11-9-14)21-13-16-5-3-4-12-20-16/h1-13H/b21-13+ |
| InChIKey | HJUGDVMRMLIQAE-FYJGNVAPSA-N |
| XLogP | 4.64 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|